C16H22N4O4 — CID 170418061
(2R)-2-[[2-[2-amino-5-(cyclopropylmethoxy)phenyl]-2-methyliminoacetyl]amino]-3-hydroxypropanamide (PubChem CID 170418061) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is (2R)-2-[[2-[2-amino-5-(cyclopropylmethoxy)phenyl]-2-methyliminoacetyl]amino]-3-hydroxypropanamide.
| Compound Name | (2R)-2-[[2-[2-amino-5-(cyclopropylmethoxy)phenyl]-2-methyliminoacetyl]amino]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 170418061 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2R)-2-[[2-[2-amino-5-(cyclopropylmethoxy)phenyl]-2-methyliminoacetyl]amino]-3-hydroxypropanamide |
| SMILES | C/N=C(\C(=O)N[C@H](CO)C(N)=O)c1cc(OCC2CC2)ccc1N |
| InChI | InChI=1S/C16H22N4O4/c1-19-14(16(23)20-13(7-21)15(18)22)11-6-10(4-5-12(11)17)24-8-9-2-3-9/h4-6,9,13,21H,2-3,7-8,17H2,1H3,(H2,18,22)(H,20,23)/b19-14-/t13-/m1/s1 |
| InChIKey | AMXGPZCEKKOIHN-ZDKYXOAUSA-N |
| XLogP | -0.56 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|