C19H26N4O4 — CID 170416827
2-[2-amino-5-(cyclobutylmethoxy)phenyl]-N-[3-(hydroxymethyl)-2-oxopyrrolidin-3-yl]-2-methyliminoacetamide (PubChem CID 170416827) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[2-amino-5-(cyclobutylmethoxy)phenyl]-N-[3-(hydroxymethyl)-2-oxopyrrolidin-3-yl]-2-methyliminoacetamide.
| Compound Name | 2-[2-amino-5-(cyclobutylmethoxy)phenyl]-N-[3-(hydroxymethyl)-2-oxopyrrolidin-3-yl]-2-methyliminoacetamide |
|---|---|
| PubChem CID | 170416827 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[2-amino-5-(cyclobutylmethoxy)phenyl]-N-[3-(hydroxymethyl)-2-oxopyrrolidin-3-yl]-2-methyliminoacetamide |
| SMILES | C/N=C(\C(=O)NC1(CO)CCNC1=O)c1cc(OCC2CCC2)ccc1N |
| InChI | InChI=1S/C19H26N4O4/c1-21-16(17(25)23-19(11-24)7-8-22-18(19)26)14-9-13(5-6-15(14)20)27-10-12-3-2-4-12/h5-6,9,12,24H,2-4,7-8,10-11,20H2,1H3,(H,22,26)(H,23,25)/b21-16- |
| InChIKey | IRSYKLHZJZUXFT-PGMHBOJBSA-N |
| XLogP | 0.23 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|