C14H20N4O4 — CID 170602626
2-[[2-(2-amino-5-methoxyphenyl)-2-methyliminoacetyl]amino]-3-hydroxy-2-methylpropanamide (PubChem CID 170602626) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[[2-(2-amino-5-methoxyphenyl)-2-methyliminoacetyl]amino]-3-hydroxy-2-methylpropanamide.
| Compound Name | 2-[[2-(2-amino-5-methoxyphenyl)-2-methyliminoacetyl]amino]-3-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 170602626 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[[2-(2-amino-5-methoxyphenyl)-2-methyliminoacetyl]amino]-3-hydroxy-2-methylpropanamide |
| SMILES | C/N=C(\C(=O)NC(C)(CO)C(N)=O)c1cc(OC)ccc1N |
| InChI | InChI=1S/C14H20N4O4/c1-14(7-19,13(16)21)18-12(20)11(17-2)9-6-8(22-3)4-5-10(9)15/h4-6,19H,7,15H2,1-3H3,(H2,16,21)(H,18,20)/b17-11- |
| InChIKey | SWCCGQZXWKODCN-BOPFTXTBSA-N |
| XLogP | -0.95 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|