C32H34F3N6O4+ — CID 170605848
N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-6-[3-[4-(4-fluorobenzoyl)-1-methylpiperazin-1-ium-1-yl]propoxy]quinoline-4-carboxamide (PubChem CID 170605848) has the molecular formula C32H34F3N6O4+ and a molecular weight of 623.66 g/mol. Its IUPAC name is N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-6-[3-[4-(4-fluorobenzoyl)-1-methylpiperazin-1-ium-1-yl]propoxy]quinoline-4-carboxamide.
| Compound Name | N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-6-[3-[4-(4-fluorobenzoyl)-1-methylpiperazin-1-ium-1-yl]propoxy]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 170605848 |
| Molecular Formula | C32H34F3N6O4+ |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-6-[3-[4-(4-fluorobenzoyl)-1-methylpiperazin-1-ium-1-yl]propoxy]quinoline-4-carboxamide |
| SMILES | C[N+]1(CCCOc2ccc3nccc(C(=O)NCC(=O)N4CC(F)(F)C[C@H]4C#N)c3c2)CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H33F3N6O4/c1-41(14-11-39(12-15-41)31(44)22-3-5-23(33)6-4-22)13-2-16-45-25-7-8-28-27(17-25)26(9-10-37-28)30(43)38-20-29(42)40-21-32(34,35)18-24(40)19-36/h3-10,17,24H,2,11-16,18,20-21H2,1H3/p+1/t24-/m0/s1 |
| InChIKey | MLJJTYGCPJYHOU-DEOSSOPVSA-O |
| XLogP | 3.23 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|