C20H19F2N7O3 — CID 171783682
6-(3-azidopropoxy)-N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 171783682) has the molecular formula C20H19F2N7O3 and a molecular weight of 443.41 g/mol. Its IUPAC name is 6-(3-azidopropoxy)-N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | 6-(3-azidopropoxy)-N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 171783682 |
| Molecular Formula | C20H19F2N7O3 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-(3-azidopropoxy)-N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | N#C[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)c1ccnc2ccc(OCCCN=[N+]=[N-])cc12 |
| InChI | InChI=1S/C20H19F2N7O3/c21-20(22)9-13(10-23)29(12-20)18(30)11-26-19(31)15-4-6-25-17-3-2-14(8-16(15)17)32-7-1-5-27-28-24/h2-4,6,8,13H,1,5,7,9,11-12H2,(H,26,31)/t13-/m0/s1 |
| InChIKey | CADSFTOWHCUMNW-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|