C24H29F3N5O4+ — CID 170605819
2-[2-[4-[[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl-(fluoromethyl)-dimethylazanium (PubChem CID 170605819) has the molecular formula C24H29F3N5O4+ and a molecular weight of 508.52 g/mol. Its IUPAC name is 2-[2-[4-[[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl-(fluoromethyl)-dimethylazanium.
| Compound Name | 2-[2-[4-[[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl-(fluoromethyl)-dimethylazanium |
|---|---|
| PubChem CID | 170605819 |
| Molecular Formula | C24H29F3N5O4+ |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2-[2-[4-[[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl-(fluoromethyl)-dimethylazanium |
| SMILES | C[N+](C)(CF)CCOCCOc1ccc2nccc(C(=O)NCC(=O)N3CC(F)(F)C[C@H]3C#N)c2c1 |
| InChI | InChI=1S/C24H28F3N5O4/c1-32(2,16-25)7-8-35-9-10-36-18-3-4-21-20(11-18)19(5-6-29-21)23(34)30-14-22(33)31-15-24(26,27)12-17(31)13-28/h3-6,11,17H,7-10,12,14-16H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | JFQBVASXLICNPC-KRWDZBQOSA-O |
| XLogP | 2.12 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|