C28H43N4O4+ — CID 170605827
dimethyl-[2-[2-[4-[[2-oxo-2-[(2R)-2,4,4-trimethylpyrrolidin-1-yl]ethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl]-propylazanium (PubChem CID 170605827) has the molecular formula C28H43N4O4+ and a molecular weight of 499.68 g/mol. Its IUPAC name is dimethyl-[2-[2-[4-[[2-oxo-2-[(2R)-2,4,4-trimethylpyrrolidin-1-yl]ethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl]-propylazanium.
| Compound Name | dimethyl-[2-[2-[4-[[2-oxo-2-[(2R)-2,4,4-trimethylpyrrolidin-1-yl]ethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl]-propylazanium |
|---|---|
| PubChem CID | 170605827 |
| Molecular Formula | C28H43N4O4+ |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | dimethyl-[2-[2-[4-[[2-oxo-2-[(2R)-2,4,4-trimethylpyrrolidin-1-yl]ethyl]carbamoyl]quinolin-6-yl]oxyethoxy]ethyl]-propylazanium |
| SMILES | CCC[N+](C)(C)CCOCCOc1ccc2nccc(C(=O)NCC(=O)N3CC(C)(C)C[C@H]3C)c2c1 |
| InChI | InChI=1S/C28H42N4O4/c1-7-12-32(5,6)13-14-35-15-16-36-22-8-9-25-24(17-22)23(10-11-29-25)27(34)30-19-26(33)31-20-28(3,4)18-21(31)2/h8-11,17,21H,7,12-16,18-20H2,1-6H3/p+1/t21-/m1/s1 |
| InChIKey | LTNZUEVBKCJRLL-OAQYLSRUSA-O |
| XLogP | 3.49 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|