C8H9BrN2O — CID 170605903
(1R,2S,5S)-3-(2-bromoacetyl)-3-azabicyclo[3.1.0]hexane-2-carbonitrile (PubChem CID 170605903) has the molecular formula C8H9BrN2O and a molecular weight of 229.08 g/mol. Its IUPAC name is (1R,2S,5S)-3-(2-bromoacetyl)-3-azabicyclo[3.1.0]hexane-2-carbonitrile.
| Compound Name | (1R,2S,5S)-3-(2-bromoacetyl)-3-azabicyclo[3.1.0]hexane-2-carbonitrile |
|---|---|
| PubChem CID | 170605903 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | (1R,2S,5S)-3-(2-bromoacetyl)-3-azabicyclo[3.1.0]hexane-2-carbonitrile |
| SMILES | N#C[C@@H]1[C@@H]2C[C@@H]2CN1C(=O)CBr |
| InChI | InChI=1S/C8H9BrN2O/c9-2-8(12)11-4-5-1-6(5)7(11)3-10/h5-7H,1-2,4H2/t5-,6-,7-/m1/s1 |
| InChIKey | PJKYRSDEXWSSPV-FSDSQADBSA-N |
| XLogP | 0.75 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|