C17H34N2 — CID 170606644
ethane;ethyl(2-methylbutyl)diazene;(3Z,5Z)-4-methylhepta-1,3,5-triene (PubChem CID 170606644) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;ethyl(2-methylbutyl)diazene;(3Z,5Z)-4-methylhepta-1,3,5-triene.
| Compound Name | ethane;ethyl(2-methylbutyl)diazene;(3Z,5Z)-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 170606644 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | ethane;ethyl(2-methylbutyl)diazene;(3Z,5Z)-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C=C/C.CC.CC/N=N/CC(C)CC |
| InChI | InChI=1S/C8H12.C7H16N2.C2H6/c1-4-6-8(3)7-5-2;1-4-7(3)6-9-8-5-2;1-2/h4-7H,1H2,2-3H3;7H,4-6H2,1-3H3;1-2H3/b7-5-,8-6-;9-8+; |
| InChIKey | PAZIZUGZPHOVDZ-LLHLAWSMSA-N |
| XLogP | 6.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|