C15H11ClN4O2 — CID 170607126
2-azido-2-benzyl-6-chloro-4H-1,4-benzoxazin-3-one (PubChem CID 170607126) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is 2-azido-2-benzyl-6-chloro-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-azido-2-benzyl-6-chloro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170607126 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-azido-2-benzyl-6-chloro-4H-1,4-benzoxazin-3-one |
| SMILES | [N-]=[N+]=NC1(Cc2ccccc2)Oc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C15H11ClN4O2/c16-11-6-7-13-12(8-11)18-14(21)15(22-13,19-20-17)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,18,21) |
| InChIKey | IMUPZJHLQMEGOF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|