C14H25FNO4PSSi — CID 170607299
[[diethoxyphosphorylmethyl-(2-fluorophenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane (PubChem CID 170607299) has the molecular formula C14H25FNO4PSSi and a molecular weight of 381.48 g/mol. Its IUPAC name is [[diethoxyphosphorylmethyl-(2-fluorophenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane.
| Compound Name | [[diethoxyphosphorylmethyl-(2-fluorophenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane |
|---|---|
| PubChem CID | 170607299 |
| Molecular Formula | C14H25FNO4PSSi |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [[diethoxyphosphorylmethyl-(2-fluorophenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane |
| SMILES | CCOP(=O)(CS(=O)(=N[Si](C)(C)C)c1ccccc1F)OCC |
| InChI | InChI=1S/C14H25FNO4PSSi/c1-6-19-21(17,20-7-2)12-22(18,16-23(3,4)5)14-11-9-8-10-13(14)15/h8-11H,6-7,12H2,1-5H3 |
| InChIKey | DPUNQUPSRYJFCE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|