C15H28NO5PSSi — CID 170607301
[[diethoxyphosphorylmethyl-(4-methoxyphenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane (PubChem CID 170607301) has the molecular formula C15H28NO5PSSi and a molecular weight of 393.52 g/mol. Its IUPAC name is [[diethoxyphosphorylmethyl-(4-methoxyphenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane.
| Compound Name | [[diethoxyphosphorylmethyl-(4-methoxyphenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane |
|---|---|
| PubChem CID | 170607301 |
| Molecular Formula | C15H28NO5PSSi |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [[diethoxyphosphorylmethyl-(4-methoxyphenyl)-oxo-λ6-sulfanylidene]amino]-trimethylsilane |
| SMILES | CCOP(=O)(CS(=O)(=N[Si](C)(C)C)c1ccc(OC)cc1)OCC |
| InChI | InChI=1S/C15H28NO5PSSi/c1-7-20-22(17,21-8-2)13-23(18,16-24(4,5)6)15-11-9-14(19-3)10-12-15/h9-12H,7-8,13H2,1-6H3 |
| InChIKey | DPFZSJAKTMDFSR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|