C13H19O7PS — CID 132518296
1-diethoxyphosphorylethenyl 4-methoxybenzenesulfonate (PubChem CID 132518296) has the molecular formula C13H19O7PS and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-diethoxyphosphorylethenyl 4-methoxybenzenesulfonate.
| Compound Name | 1-diethoxyphosphorylethenyl 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 132518296 |
| Molecular Formula | C13H19O7PS |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-diethoxyphosphorylethenyl 4-methoxybenzenesulfonate |
| SMILES | C=C(OS(=O)(=O)c1ccc(OC)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H19O7PS/c1-5-18-21(14,19-6-2)11(3)20-22(15,16)13-9-7-12(17-4)8-10-13/h7-10H,3,5-6H2,1-2,4H3 |
| InChIKey | MMRFEOOFFYMEDX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|