C26H27BClN5OS — CID 170607530
CID 170607530 (PubChem CID 170607530) has the molecular formula C26H27BClN5OS and a molecular weight of 503.87 g/mol.
| Compound Name | CID 170607530 |
|---|---|
| PubChem CID | 170607530 |
| Molecular Formula | C26H27BClN5OS |
| Molecular Weight | 503.87 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | — |
| SMILES | [B]c1cccnc1N1CCN(/C(=N\NS(=O)c2ccc(C)cc2)c2c(C)cccc2Cl)C2(CC2)C1 |
| InChI | InChI=1S/C26H27BClN5OS/c1-18-8-10-20(11-9-18)35(34)31-30-25(23-19(2)5-3-7-22(23)28)33-16-15-32(17-26(33)12-13-26)24-21(27)6-4-14-29-24/h3-11,14,31H,12-13,15-17H2,1-2H3/b30-25- |
| InChIKey | LNXOEOYVESAKPK-JVCXMKTPSA-N |
| XLogP | 3.47 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|