C24H22Cl3FN6O2S — CID 170608144
N-[(Z)-[[7-(5-chloropyrimidin-2-yl)-4,7-diazaspiro[2.5]octan-4-yl]-(2,6-dichloro-4-fluorophenyl)methylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 170608144) has the molecular formula C24H22Cl3FN6O2S and a molecular weight of 583.90 g/mol. Its IUPAC name is N-[(Z)-[[7-(5-chloropyrimidin-2-yl)-4,7-diazaspiro[2.5]octan-4-yl]-(2,6-dichloro-4-fluorophenyl)methylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[[7-(5-chloropyrimidin-2-yl)-4,7-diazaspiro[2.5]octan-4-yl]-(2,6-dichloro-4-fluorophenyl)methylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170608144 |
| Molecular Formula | C24H22Cl3FN6O2S |
| Molecular Weight | 583.90 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | N-[(Z)-[[7-(5-chloropyrimidin-2-yl)-4,7-diazaspiro[2.5]octan-4-yl]-(2,6-dichloro-4-fluorophenyl)methylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(/c2c(Cl)cc(F)cc2Cl)N2CCN(c3ncc(Cl)cn3)CC23CC3)cc1 |
| InChI | InChI=1S/C24H22Cl3FN6O2S/c1-15-2-4-18(5-3-15)37(35,36)32-31-22(21-19(26)10-17(28)11-20(21)27)34-9-8-33(14-24(34)6-7-24)23-29-12-16(25)13-30-23/h2-5,10-13,32H,6-9,14H2,1H3/b31-22- |
| InChIKey | ISZBXJMAMAARRO-VAMRJTSQSA-N |
| XLogP | 4.88 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|