C14H10Cl2F2N2O2S — CID 170607858
(1Z)-2-chloro-3,6-difluoro-N-(4-methylphenyl)sulfonylbenzenecarbohydrazonoyl chloride (PubChem CID 170607858) has the molecular formula C14H10Cl2F2N2O2S and a molecular weight of 379.22 g/mol. Its IUPAC name is (1Z)-2-chloro-3,6-difluoro-N-(4-methylphenyl)sulfonylbenzenecarbohydrazonoyl chloride.
| Compound Name | (1Z)-2-chloro-3,6-difluoro-N-(4-methylphenyl)sulfonylbenzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 170607858 |
| Molecular Formula | C14H10Cl2F2N2O2S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | (1Z)-2-chloro-3,6-difluoro-N-(4-methylphenyl)sulfonylbenzenecarbohydrazonoyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(\Cl)c2c(F)ccc(F)c2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2F2N2O2S/c1-8-2-4-9(5-3-8)23(21,22)20-19-14(16)12-10(17)6-7-11(18)13(12)15/h2-7,20H,1H3/b19-14- |
| InChIKey | SDFNJSJFOWLAPD-RGEXLXHISA-N |
| XLogP | 3.81 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|