C20H24FIN4O2S — CID 88570156
N-[(Z)-[(4-ethylpiperazin-1-yl)-(2-fluoro-5-iodophenyl)methylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 88570156) has the molecular formula C20H24FIN4O2S and a molecular weight of 530.41 g/mol. Its IUPAC name is N-[(Z)-[(4-ethylpiperazin-1-yl)-(2-fluoro-5-iodophenyl)methylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(4-ethylpiperazin-1-yl)-(2-fluoro-5-iodophenyl)methylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 88570156 |
| Molecular Formula | C20H24FIN4O2S |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | N-[(Z)-[(4-ethylpiperazin-1-yl)-(2-fluoro-5-iodophenyl)methylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | CCN1CCN(/C(=N\NS(=O)(=O)c2ccc(C)cc2)c2cc(I)ccc2F)CC1 |
| InChI | InChI=1S/C20H24FIN4O2S/c1-3-25-10-12-26(13-11-25)20(18-14-16(22)6-9-19(18)21)23-24-29(27,28)17-7-4-15(2)5-8-17/h4-9,14,24H,3,10-13H2,1-2H3/b23-20- |
| InChIKey | VZZIMZQTYPLJLL-ATJXCDBQSA-N |
| XLogP | 3.02 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|