C24H21ClF4N6O2S2 — CID 170607887
N-[3-chloro-2-[7-(5-fluoropyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide (PubChem CID 170607887) has the molecular formula C24H21ClF4N6O2S2 and a molecular weight of 601.05 g/mol. Its IUPAC name is N-[3-chloro-2-[7-(5-fluoropyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide.
| Compound Name | N-[3-chloro-2-[7-(5-fluoropyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 170607887 |
| Molecular Formula | C24H21ClF4N6O2S2 |
| Molecular Weight | 601.05 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | N-[3-chloro-2-[7-(5-fluoropyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide |
| SMILES | [H]/N=C(\c1c(Cl)cccc1NS(=O)(=O)c1ccc(SC(F)(F)F)cc1)N1CCN(c2ncc(F)cn2)CC12CC2 |
| InChI | InChI=1S/C24H21ClF4N6O2S2/c25-18-2-1-3-19(33-39(36,37)17-6-4-16(5-7-17)38-24(27,28)29)20(18)21(30)35-11-10-34(14-23(35)8-9-23)22-31-12-15(26)13-32-22/h1-7,12-13,30,33H,8-11,14H2/b30-21+ |
| InChIKey | XGJXGXFHGQCDQB-MWAVMZGNSA-N |
| XLogP | 5.36 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.05 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|