C19H19Cl2F2N3O2S — CID 176557103
4-chloro-N-[3-chloro-2-(1-ethyl-4,4-difluoropyrrolidine-2-carboximidoyl)phenyl]benzenesulfonamide (PubChem CID 176557103) has the molecular formula C19H19Cl2F2N3O2S and a molecular weight of 462.35 g/mol. Its IUPAC name is 4-chloro-N-[3-chloro-2-(1-ethyl-4,4-difluoropyrrolidine-2-carboximidoyl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-chloro-2-(1-ethyl-4,4-difluoropyrrolidine-2-carboximidoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 176557103 |
| Molecular Formula | C19H19Cl2F2N3O2S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 4-chloro-N-[3-chloro-2-(1-ethyl-4,4-difluoropyrrolidine-2-carboximidoyl)phenyl]benzenesulfonamide |
| SMILES | [H]/N=C(/c1c(Cl)cccc1NS(=O)(=O)c1ccc(Cl)cc1)C1CC(F)(F)CN1CC |
| InChI | InChI=1S/C19H19Cl2F2N3O2S/c1-2-26-11-19(22,23)10-16(26)18(24)17-14(21)4-3-5-15(17)25-29(27,28)13-8-6-12(20)7-9-13/h3-9,16,24-25H,2,10-11H2,1H3/b24-18+ |
| InChIKey | QLWADUMEMHKKJS-HKOYGPOVSA-N |
| XLogP | 4.89 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|