C25H29FN6O3S3 — CID 170607749
N-[5-fluoro-3-methyl-2-(7-pyrimidin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-5-propan-2-ylsulfinylthiophene-2-sulfonamide (PubChem CID 170607749) has the molecular formula C25H29FN6O3S3 and a molecular weight of 576.75 g/mol. Its IUPAC name is N-[5-fluoro-3-methyl-2-(7-pyrimidin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-5-propan-2-ylsulfinylthiophene-2-sulfonamide.
| Compound Name | N-[5-fluoro-3-methyl-2-(7-pyrimidin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-5-propan-2-ylsulfinylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 170607749 |
| Molecular Formula | C25H29FN6O3S3 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | N-[5-fluoro-3-methyl-2-(7-pyrimidin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-5-propan-2-ylsulfinylthiophene-2-sulfonamide |
| SMILES | [H]/N=C(\c1c(C)cc(F)cc1NS(=O)(=O)c1ccc(S(=O)C(C)C)s1)N1CCN(c2ncccn2)CC12CC2 |
| InChI | InChI=1S/C25H29FN6O3S3/c1-16(2)37(33)20-5-6-21(36-20)38(34,35)30-19-14-18(26)13-17(3)22(19)23(27)32-12-11-31(15-25(32)7-8-25)24-28-9-4-10-29-24/h4-6,9-10,13-14,16,27,30H,7-8,11-12,15H2,1-3H3/b27-23+ |
| InChIKey | SMKAREHMZHKUHN-SLEBQGDGSA-N |
| XLogP | 3.98 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|