C22H30N4O3S2 — CID 170607682
N-[2-(5-azaspiro[2.5]octane-5-carboximidoyl)-3-methylphenyl]-1-propan-2-ylsulfinylpyrrole-3-sulfonamide (PubChem CID 170607682) has the molecular formula C22H30N4O3S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-[2-(5-azaspiro[2.5]octane-5-carboximidoyl)-3-methylphenyl]-1-propan-2-ylsulfinylpyrrole-3-sulfonamide.
| Compound Name | N-[2-(5-azaspiro[2.5]octane-5-carboximidoyl)-3-methylphenyl]-1-propan-2-ylsulfinylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 170607682 |
| Molecular Formula | C22H30N4O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[2-(5-azaspiro[2.5]octane-5-carboximidoyl)-3-methylphenyl]-1-propan-2-ylsulfinylpyrrole-3-sulfonamide |
| SMILES | [H]/N=C(/c1c(C)cccc1NS(=O)(=O)c1ccn(S(=O)C(C)C)c1)N1CCCC2(CC2)C1 |
| InChI | InChI=1S/C22H30N4O3S2/c1-16(2)30(27)26-13-8-18(14-26)31(28,29)24-19-7-4-6-17(3)20(19)21(23)25-12-5-9-22(15-25)10-11-22/h4,6-8,13-14,16,23-24H,5,9-12,15H2,1-3H3/b23-21- |
| InChIKey | GWRNDFBSJFBVGD-LNVKXUELSA-N |
| XLogP | 3.72 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|