C28H34N6O2S2 — CID 170607620
3-methyl-2-[7-(5-methylpyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-N-(3-propan-2-ylsulfonylphenyl)sulfanylaniline (PubChem CID 170607620) has the molecular formula C28H34N6O2S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 3-methyl-2-[7-(5-methylpyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-N-(3-propan-2-ylsulfonylphenyl)sulfanylaniline.
| Compound Name | 3-methyl-2-[7-(5-methylpyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-N-(3-propan-2-ylsulfonylphenyl)sulfanylaniline |
|---|---|
| PubChem CID | 170607620 |
| Molecular Formula | C28H34N6O2S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 3-methyl-2-[7-(5-methylpyrimidin-2-yl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-N-(3-propan-2-ylsulfonylphenyl)sulfanylaniline |
| SMILES | [H]/N=C(\c1c(C)cccc1NSc1cccc(S(=O)(=O)C(C)C)c1)N1CCN(c2ncc(C)cn2)CC12CC2 |
| InChI | InChI=1S/C28H34N6O2S2/c1-19(2)38(35,36)23-9-6-8-22(15-23)37-32-24-10-5-7-21(4)25(24)26(29)34-14-13-33(18-28(34)11-12-28)27-30-16-20(3)17-31-27/h5-10,15-17,19,29,32H,11-14,18H2,1-4H3/b29-26+ |
| InChIKey | AYDVBPXNQKZADL-PBBVDAKRSA-N |
| XLogP | 5.07 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|