C20H21F3N8OS — CID 170607881
[2-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-5-fluoroanilino] (NZ)-N-(aminomethylidene)-N'-hydroxycarbamimidothioate (PubChem CID 170607881) has the molecular formula C20H21F3N8OS and a molecular weight of 478.50 g/mol. Its IUPAC name is [2-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-5-fluoroanilino] (NZ)-N-(aminomethylidene)-N'-hydroxycarbamimidothioate.
| Compound Name | [2-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-5-fluoroanilino] (NZ)-N-(aminomethylidene)-N'-hydroxycarbamimidothioate |
|---|---|
| PubChem CID | 170607881 |
| Molecular Formula | C20H21F3N8OS |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | [2-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]-5-fluoroanilino] (NZ)-N-(aminomethylidene)-N'-hydroxycarbamimidothioate |
| SMILES | [H]/N=C(\c1ccc(F)cc1NSC(/N=C\N)=N/O)N1CCN(c2ncc(F)cc2F)CC12CC2 |
| InChI | InChI=1S/C20H21F3N8OS/c21-12-1-2-14(16(8-12)29-33-19(28-32)27-11-24)17(25)31-6-5-30(10-20(31)3-4-20)18-15(23)7-13(22)9-26-18/h1-2,7-9,11,25,29,32H,3-6,10H2,(H2,24,27,28)/b25-17+ |
| InChIKey | LFUFEVBELMNMJC-KOEQRZSOSA-N |
| XLogP | 2.97 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|