C25H25F2N5O2S — CID 170608051
N-[3-fluoro-2-[7-(5-fluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 170608051) has the molecular formula C25H25F2N5O2S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[3-fluoro-2-[7-(5-fluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-fluoro-2-[7-(5-fluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170608051 |
| Molecular Formula | C25H25F2N5O2S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[3-fluoro-2-[7-(5-fluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octane-4-carboximidoyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | [H]/N=C(\c1c(F)cccc1NS(=O)(=O)c1ccc(C)cc1)N1CCN(c2ccc(F)cn2)CC12CC2 |
| InChI | InChI=1S/C25H25F2N5O2S/c1-17-5-8-19(9-6-17)35(33,34)30-21-4-2-3-20(27)23(21)24(28)32-14-13-31(16-25(32)11-12-25)22-10-7-18(26)15-29-22/h2-10,15,28,30H,11-14,16H2,1H3/b28-24+ |
| InChIKey | CKCDWMNCRGEYDK-ZZIIXHQDSA-N |
| XLogP | 4.15 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|