C26H28FN5O2S — CID 170608135
N-[5-fluoro-3-methyl-2-(7-pyridin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 170608135) has the molecular formula C26H28FN5O2S and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[5-fluoro-3-methyl-2-(7-pyridin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-fluoro-3-methyl-2-(7-pyridin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170608135 |
| Molecular Formula | C26H28FN5O2S |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[5-fluoro-3-methyl-2-(7-pyridin-2-yl-4,7-diazaspiro[2.5]octane-4-carboximidoyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | [H]/N=C(\c1c(C)cc(F)cc1NS(=O)(=O)c1ccc(C)cc1)N1CCN(c2ccccn2)CC12CC2 |
| InChI | InChI=1S/C26H28FN5O2S/c1-18-6-8-21(9-7-18)35(33,34)30-22-16-20(27)15-19(2)24(22)25(28)32-14-13-31(17-26(32)10-11-26)23-5-3-4-12-29-23/h3-9,12,15-16,28,30H,10-11,13-14,17H2,1-2H3/b28-25+ |
| InChIKey | LAGLFIXEXBPQRT-AZPGRJICSA-N |
| XLogP | 4.32 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|