C25H22Cl2F3N5O2S — CID 170607539
N-[(Z)-[(2,6-dichloro-4-fluorophenyl)-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octan-4-yl]methylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 170607539) has the molecular formula C25H22Cl2F3N5O2S and a molecular weight of 584.45 g/mol. Its IUPAC name is N-[(Z)-[(2,6-dichloro-4-fluorophenyl)-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octan-4-yl]methylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(2,6-dichloro-4-fluorophenyl)-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octan-4-yl]methylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170607539 |
| Molecular Formula | C25H22Cl2F3N5O2S |
| Molecular Weight | 584.45 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | N-[(Z)-[(2,6-dichloro-4-fluorophenyl)-[7-(3,5-difluoro-2-pyridinyl)-4,7-diazaspiro[2.5]octan-4-yl]methylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(/c2c(Cl)cc(F)cc2Cl)N2CCN(c3ncc(F)cc3F)CC23CC3)cc1 |
| InChI | InChI=1S/C25H22Cl2F3N5O2S/c1-15-2-4-18(5-3-15)38(36,37)33-32-24(22-19(26)10-16(28)11-20(22)27)35-9-8-34(14-25(35)6-7-25)23-21(30)12-17(29)13-31-23/h2-5,10-13,33H,6-9,14H2,1H3/b32-24- |
| InChIKey | FXLUSGXIGZOFSF-TZHWMEPESA-N |
| XLogP | 5.11 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|