C28H31ClFN3O3S — CID 166447475
N-[(Z)-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 166447475) has the molecular formula C28H31ClFN3O3S and a molecular weight of 544.09 g/mol. Its IUPAC name is N-[(Z)-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 166447475 |
| Molecular Formula | C28H31ClFN3O3S |
| Molecular Weight | 544.09 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-[(Z)-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(/CCCN2CCC(O)(c3ccc(Cl)cc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H31ClFN3O3S/c1-21-4-14-26(15-5-21)37(35,36)32-31-27(22-6-12-25(30)13-7-22)3-2-18-33-19-16-28(34,17-20-33)23-8-10-24(29)11-9-23/h4-15,32,34H,2-3,16-20H2,1H3/b31-27- |
| InChIKey | KNGALHIVVOMDMC-QVTSOHHYSA-N |
| XLogP | 5.23 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.09 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|