C14H13Cl2FN4 — CID 171327142
2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-fluoropyrimidine (PubChem CID 171327142) has the molecular formula C14H13Cl2FN4 and a molecular weight of 327.19 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-fluoropyrimidine.
| Compound Name | 2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-fluoropyrimidine |
|---|---|
| PubChem CID | 171327142 |
| Molecular Formula | C14H13Cl2FN4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-fluoropyrimidine |
| SMILES | Fc1cnc(N2CCN(c3cccc(Cl)c3Cl)CC2)nc1 |
| InChI | InChI=1S/C14H13Cl2FN4/c15-11-2-1-3-12(13(11)16)20-4-6-21(7-5-20)14-18-8-10(17)9-19-14/h1-3,8-9H,4-7H2 |
| InChIKey | WPKLFMIGIIDANR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |