C16H13Cl2N3O4 — CID 170608576
3-[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]-5-(hydroxymethyl)imidazolidine-2,4-dione (PubChem CID 170608576) has the molecular formula C16H13Cl2N3O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is 3-[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]-5-(hydroxymethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]-5-(hydroxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 170608576 |
| Molecular Formula | C16H13Cl2N3O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3-[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]-5-(hydroxymethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(CO)C(=O)N1c1ccc(OCc2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C16H13Cl2N3O4/c17-11-2-1-3-12(18)10(11)8-25-9-4-5-14(19-6-9)21-15(23)13(7-22)20-16(21)24/h1-6,13,22H,7-8H2,(H,20,24) |
| InChIKey | CLFWQFOSFVVDRS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|