About [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol
[1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol (PubChem CID 170608510) has the molecular formula C17H14Cl2N2O2
and a molecular weight of 349.22 g/mol. Its IUPAC name is [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol |
| PubChem CID | 170608510 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol |
| SMILES | OCc1cnn(-c2ccc(OCc3c(Cl)cccc3Cl)cc2)c1 |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-16-2-1-3-17(19)15(16)11-23-14-6-4-13(5-7-14)21-9-12(10-22)8-20-21/h1-9,22H,10-11H2 |
| InChIKey | CLCKOBFXMCGERL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol?
The IUPAC name of [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol (CID 170608510) is [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol.
What is the SMILES notation for [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol?
The canonical SMILES for [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol is OCc1cnn(-c2ccc(OCc3c(Cl)cccc3Cl)cc2)c1.
What is the InChIKey of [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol?
The InChIKey is CLCKOBFXMCGERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2O2/c18-16-2-1-3-17(19)15(16)11-23-14-6-4-13(5-7-14)21-9-12(10-22)8-20-21/h1-9,22H,10-11H2.
What are the key properties of [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol?
[1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol has a molecular weight of 349.22 g/mol, XLogP of 4.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]pyrazol-4-yl]methanol is sourced from PubChem (CID 170608510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).