C12H12Cl2N6O — CID 170608782
N,N'-diamino-5-[(2,6-dichlorophenyl)methoxy]pyrimidine-2-carboximidamide (PubChem CID 170608782) has the molecular formula C12H12Cl2N6O and a molecular weight of 327.18 g/mol. Its IUPAC name is N,N'-diamino-5-[(2,6-dichlorophenyl)methoxy]pyrimidine-2-carboximidamide.
| Compound Name | N,N'-diamino-5-[(2,6-dichlorophenyl)methoxy]pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 170608782 |
| Molecular Formula | C12H12Cl2N6O |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N,N'-diamino-5-[(2,6-dichlorophenyl)methoxy]pyrimidine-2-carboximidamide |
| SMILES | N/N=C(\NN)c1ncc(OCc2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C12H12Cl2N6O/c13-9-2-1-3-10(14)8(9)6-21-7-4-17-11(18-5-7)12(19-15)20-16/h1-5H,6,15-16H2,(H,19,20) |
| InChIKey | IHKSZENWORMSHW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|