C31H46ClN7O4Si- — CID 170609794
CID 170609794 (PubChem CID 170609794) has the molecular formula C31H46ClN7O4Si- and a molecular weight of 644.29 g/mol.
| Compound Name | CID 170609794 |
|---|---|
| PubChem CID | 170609794 |
| Molecular Formula | C31H46ClN7O4Si- |
| Molecular Weight | 644.29 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)cc2c1c(-c1cnn(C3CCCCO3)c1)cn2C1=CN(CCO[Si-](C)(C)C(C)(C)C)NN1 |
| InChI | InChI=1S/C31H46ClN7O4Si/c1-30(2,3)43-29(40)34-24-15-22(32)16-25-28(24)23(21-17-33-39(18-21)27-11-9-10-13-41-27)19-38(25)26-20-37(36-35-26)12-14-42-44(7,8)31(4,5)6/h15-20,27,35-36H,9-14H2,1-8H3,(H,34,40)/q-1 |
| InChIKey | WWOPAXQCIQQCKB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.29 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|