About CID 170609794
CID 170609794 (PubChem CID 170609794) has the molecular formula C31H46ClN7O4Si-
and a molecular weight of 644.29 g/mol.
Molecular Properties
| Compound Name | CID 170609794 |
| PubChem CID | 170609794 |
| Molecular Formula | C31H46ClN7O4Si- |
| Molecular Weight | 644.29 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)cc2c1c(-c1cnn(C3CCCCO3)c1)cn2C1=CN(CCO[Si-](C)(C)C(C)(C)C)NN1 |
| InChI | InChI=1S/C31H46ClN7O4Si/c1-30(2,3)43-29(40)34-24-15-22(32)16-25-28(24)23(21-17-33-39(18-21)27-11-9-10-13-41-27)19-38(25)26-20-37(36-35-26)12-14-42-44(7,8)31(4,5)6/h15-20,27,35-36H,9-14H2,1-8H3,(H,34,40)/q-1 |
| InChIKey | WWOPAXQCIQQCKB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.29 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170609794 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170609794?
The IUPAC name of CID 170609794 (CID 170609794) is not available.
What is the SMILES notation for CID 170609794?
The canonical SMILES for CID 170609794 is CC(C)(C)OC(=O)Nc1cc(Cl)cc2c1c(-c1cnn(C3CCCCO3)c1)cn2C1=CN(CCO[Si-](C)(C)C(C)(C)C)NN1.
What is the InChIKey of CID 170609794?
The InChIKey is WWOPAXQCIQQCKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H46ClN7O4Si/c1-30(2,3)43-29(40)34-24-15-22(32)16-25-28(24)23(21-17-33-39(18-21)27-11-9-10-13-41-27)19-38(25)26-20-37(36-35-26)12-14-42-44(7,8)31(4,5)6/h15-20,27,35-36H,9-14H2,1-8H3,(H,34,40)/q-1.
What are the key properties of CID 170609794?
CID 170609794 has a molecular weight of 644.29 g/mol, XLogP of 7.31, 8 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170609794 is sourced from PubChem (CID 170609794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).