C25H26U — CID 170611080
1,2-dimethyl-4-[1-(4-methylbenzene-6-id-1-yl)-1-(4-methylphenyl)propan-2-yl]benzene;uranium(2+) (PubChem CID 170611080) has the molecular formula C25H26U and a molecular weight of 564.51 g/mol. Its IUPAC name is 1,2-dimethyl-4-[1-(4-methylbenzene-6-id-1-yl)-1-(4-methylphenyl)propan-2-yl]benzene;uranium(2+).
| Compound Name | 1,2-dimethyl-4-[1-(4-methylbenzene-6-id-1-yl)-1-(4-methylphenyl)propan-2-yl]benzene;uranium(2+) |
|---|---|
| PubChem CID | 170611080 |
| Molecular Formula | C25H26U |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 1,2-dimethyl-4-[1-(4-methylbenzene-6-id-1-yl)-1-(4-methylphenyl)propan-2-yl]benzene;uranium(2+) |
| SMILES | [CH2-]C(c1ccc(C)c(C)c1)C(c1[c-]cc(C)cc1)c1ccc(C)cc1.[U+2] |
| InChI | InChI=1S/C25H26.U/c1-17-6-11-22(12-7-17)25(23-13-8-18(2)9-14-23)21(5)24-15-10-19(3)20(4)16-24;/h6-13,15-16,21,25H,5H2,1-4H3;/q-2;+2 |
| InChIKey | IRLKELHYDSTQLI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|