C27H27BrF4N4O5 — CID 170612086
tert-butyl N-[2-[2-[2-[(2-bromo-6-methoxy-3-pyridinyl)carbamoyl]-4-(trifluoromethyl)anilino]-5-fluorophenoxy]ethyl]carbamate (PubChem CID 170612086) has the molecular formula C27H27BrF4N4O5 and a molecular weight of 643.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[(2-bromo-6-methoxy-3-pyridinyl)carbamoyl]-4-(trifluoromethyl)anilino]-5-fluorophenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[(2-bromo-6-methoxy-3-pyridinyl)carbamoyl]-4-(trifluoromethyl)anilino]-5-fluorophenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170612086 |
| Molecular Formula | C27H27BrF4N4O5 |
| Molecular Weight | 643.43 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[(2-bromo-6-methoxy-3-pyridinyl)carbamoyl]-4-(trifluoromethyl)anilino]-5-fluorophenoxy]ethyl]carbamate |
| SMILES | COc1ccc(NC(=O)c2cc(C(F)(F)F)ccc2Nc2ccc(F)cc2OCCNC(=O)OC(C)(C)C)c(Br)n1 |
| InChI | InChI=1S/C27H27BrF4N4O5/c1-26(2,3)41-25(38)33-11-12-40-21-14-16(29)6-8-19(21)34-18-7-5-15(27(30,31)32)13-17(18)24(37)35-20-9-10-22(39-4)36-23(20)28/h5-10,13-14,34H,11-12H2,1-4H3,(H,33,38)(H,35,37) |
| InChIKey | VTPKTYJWQXPWNG-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.43 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|