C21H16ClF4N3O2 — CID 155452663
N-(2-chloro-6-methoxy-3-pyridinyl)-2-(4-fluoro-2-methylanilino)-5-(trifluoromethyl)benzamide (PubChem CID 155452663) has the molecular formula C21H16ClF4N3O2 and a molecular weight of 453.82 g/mol. Its IUPAC name is N-(2-chloro-6-methoxy-3-pyridinyl)-2-(4-fluoro-2-methylanilino)-5-(trifluoromethyl)benzamide.
| Compound Name | N-(2-chloro-6-methoxy-3-pyridinyl)-2-(4-fluoro-2-methylanilino)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155452663 |
| Molecular Formula | C21H16ClF4N3O2 |
| Molecular Weight | 453.82 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-(2-chloro-6-methoxy-3-pyridinyl)-2-(4-fluoro-2-methylanilino)-5-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(C(F)(F)F)ccc2Nc2ccc(F)cc2C)c(Cl)n1 |
| InChI | InChI=1S/C21H16ClF4N3O2/c1-11-9-13(23)4-6-15(11)27-16-5-3-12(21(24,25)26)10-14(16)20(30)28-17-7-8-18(31-2)29-19(17)22/h3-10,27H,1-2H3,(H,28,30) |
| InChIKey | LORUTOHUKAXNEL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.82 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|