C13H20N4O2 — CID 170612441
[3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] 2-methylazetidine-1-carboxylate (PubChem CID 170612441) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is [3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] 2-methylazetidine-1-carboxylate.
| Compound Name | [3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] 2-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 170612441 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [3-(3-amino-1H-pyrazol-5-yl)cyclopentyl] 2-methylazetidine-1-carboxylate |
| SMILES | CC1CCN1C(=O)OC1CCC(c2cc(N)n[nH]2)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-8-4-5-17(8)13(18)19-10-3-2-9(6-10)11-7-12(14)16-15-11/h7-10H,2-6H2,1H3,(H3,14,15,16) |
| InChIKey | YSKKYGWRMZKQKW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |