C23H37N5O4 — CID 170613108
N-[(4-ethynylphenyl)methyl]formamide;hydrazine;5-(3-hydroxypyrrolidin-1-yl)-N,N,3,3-tetramethyl-5-oxopentanamide (PubChem CID 170613108) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[(4-ethynylphenyl)methyl]formamide;hydrazine;5-(3-hydroxypyrrolidin-1-yl)-N,N,3,3-tetramethyl-5-oxopentanamide.
| Compound Name | N-[(4-ethynylphenyl)methyl]formamide;hydrazine;5-(3-hydroxypyrrolidin-1-yl)-N,N,3,3-tetramethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 170613108 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | N-[(4-ethynylphenyl)methyl]formamide;hydrazine;5-(3-hydroxypyrrolidin-1-yl)-N,N,3,3-tetramethyl-5-oxopentanamide |
| SMILES | C#Cc1ccc(CNC=O)cc1.CN(C)C(=O)CC(C)(C)CC(=O)N1CCC(O)C1.NN |
| InChI | InChI=1S/C13H24N2O3.C10H9NO.H4N2/c1-13(2,7-11(17)14(3)4)8-12(18)15-6-5-10(16)9-15;1-2-9-3-5-10(6-4-9)7-11-8-12;1-2/h10,16H,5-9H2,1-4H3;1,3-6,8H,7H2,(H,11,12);1-2H2 |
| InChIKey | HZAXWIXFTVDBHZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|