C21H35N5O3 — CID 170613167
1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanamine;N-[(1-methylindazol-5-yl)methyl]formamide (PubChem CID 170613167) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanamine;N-[(1-methylindazol-5-yl)methyl]formamide.
| Compound Name | 1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanamine;N-[(1-methylindazol-5-yl)methyl]formamide |
|---|---|
| PubChem CID | 170613167 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanamine;N-[(1-methylindazol-5-yl)methyl]formamide |
| SMILES | CC(C)(C)CC(=O)N1CCC(O)C1.CN.Cn1ncc2cc(CNC=O)ccc21 |
| InChI | InChI=1S/C10H11N3O.C10H19NO2.CH5N/c1-13-10-3-2-8(5-11-7-14)4-9(10)6-12-13;1-10(2,3)6-9(13)11-5-4-8(12)7-11;1-2/h2-4,6-7H,5H2,1H3,(H,11,14);8,12H,4-7H2,1-3H3;2H2,1H3 |
| InChIKey | IMYLNEFMIQVDAD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|