C21H32F2N4O4 — CID 170613704
N-[[2-(difluoromethoxy)-4-ethynylphenyl]methyl]formamide;hydrazine;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 170613704) has the molecular formula C21H32F2N4O4 and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-4-ethynylphenyl]methyl]formamide;hydrazine;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | N-[[2-(difluoromethoxy)-4-ethynylphenyl]methyl]formamide;hydrazine;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 170613704 |
| Molecular Formula | C21H32F2N4O4 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-[[2-(difluoromethoxy)-4-ethynylphenyl]methyl]formamide;hydrazine;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | C#Cc1ccc(CNC=O)c(OC(F)F)c1.CC(C)(C)CC(=O)N1CCC(O)C1.NN |
| InChI | InChI=1S/C11H9F2NO2.C10H19NO2.H4N2/c1-2-8-3-4-9(6-14-7-15)10(5-8)16-11(12)13;1-10(2,3)6-9(13)11-5-4-8(12)7-11;1-2/h1,3-5,7,11H,6H2,(H,14,15);8,12H,4-7H2,1-3H3;1-2H2 |
| InChIKey | KBGJKRVOAWERHD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|