About 1-hexylpiperazin-4-ium;yttrium
1-hexylpiperazin-4-ium;yttrium (PubChem CID 170614951) has the molecular formula C10H22N2Y
and a molecular weight of 259.21 g/mol. Its IUPAC name is 1-hexylpiperazin-4-ium;yttrium.
Molecular Properties
| Compound Name | 1-hexylpiperazin-4-ium;yttrium |
| PubChem CID | 170614951 |
| Molecular Formula | C10H22N2Y |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-hexylpiperazin-4-ium;yttrium |
| SMILES | [CH2-]CCCCCN1CC[NH2+]CC1.[Y] |
| InChI | InChI=1S/C10H21N2.Y/c1-2-3-4-5-8-12-9-6-11-7-10-12;/h11H,1-10H2;/q-1;/p+1 |
| InChIKey | UOXOVDWZEIBNMB-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylpiperazin-4-ium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylpiperazin-4-ium;yttrium?
The IUPAC name of 1-hexylpiperazin-4-ium;yttrium (CID 170614951) is 1-hexylpiperazin-4-ium;yttrium.
What is the SMILES notation for 1-hexylpiperazin-4-ium;yttrium?
The canonical SMILES for 1-hexylpiperazin-4-ium;yttrium is [CH2-]CCCCCN1CC[NH2+]CC1.[Y].
What is the InChIKey of 1-hexylpiperazin-4-ium;yttrium?
The InChIKey is UOXOVDWZEIBNMB-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H21N2.Y/c1-2-3-4-5-8-12-9-6-11-7-10-12;/h11H,1-10H2;/q-1;/p+1.
What are the key properties of 1-hexylpiperazin-4-ium;yttrium?
1-hexylpiperazin-4-ium;yttrium has a molecular weight of 259.21 g/mol, XLogP of 0.26, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylpiperazin-4-ium;yttrium is sourced from PubChem (CID 170614951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).