C17H34BBrIN3O4S — CID 170617756
tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-[2-[iodo(methoxy)boranyl]sulfanylethyl]carbamate;ethane;ethanol (PubChem CID 170617756) has the molecular formula C17H34BBrIN3O4S and a molecular weight of 594.16 g/mol. Its IUPAC name is tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-[2-[iodo(methoxy)boranyl]sulfanylethyl]carbamate;ethane;ethanol.
| Compound Name | tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-[2-[iodo(methoxy)boranyl]sulfanylethyl]carbamate;ethane;ethanol |
|---|---|
| PubChem CID | 170617756 |
| Molecular Formula | C17H34BBrIN3O4S |
| Molecular Weight | 594.16 g/mol |
| Exact Mass | 593.06 |
| IUPAC Name | tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-[2-[iodo(methoxy)boranyl]sulfanylethyl]carbamate;ethane;ethanol |
| SMILES | CC.CCO.COB(I)SCCN(Cc1c(Br)cnn1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22BBrIN3O3S.C2H6O.C2H6/c1-13(2,3)22-12(20)19(6-7-23-14(16)21-5)9-11-10(15)8-17-18(11)4;1-2-3;1-2/h8H,6-7,9H2,1-5H3;3H,2H2,1H3;1-2H3 |
| InChIKey | NHXKDHQRAWMXNB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.16 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|