C11H23N4O2P — CID 170621916
N-[5-(aminomethylideneamino)-1-oxo-1-phosphanylpentan-2-yl]-N-[2-(methylamino)ethyl]acetamide (PubChem CID 170621916) has the molecular formula C11H23N4O2P and a molecular weight of 274.30 g/mol. Its IUPAC name is N-[5-(aminomethylideneamino)-1-oxo-1-phosphanylpentan-2-yl]-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | N-[5-(aminomethylideneamino)-1-oxo-1-phosphanylpentan-2-yl]-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 170621916 |
| Molecular Formula | C11H23N4O2P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-[5-(aminomethylideneamino)-1-oxo-1-phosphanylpentan-2-yl]-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCN(C(C)=O)C(CCC/N=C/N)C(=O)P |
| InChI | InChI=1S/C11H23N4O2P/c1-9(16)15(7-6-13-2)10(11(17)18)4-3-5-14-8-12/h8,10,13H,3-7,18H2,1-2H3,(H2,12,14) |
| InChIKey | WMIXMNPBBJRYRA-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|