C20H23FN2O4S — CID 17062248
ethyl 5-(butylcarbamoyl)-2-[(3-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 17062248) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 5-(butylcarbamoyl)-2-[(3-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(butylcarbamoyl)-2-[(3-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17062248 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | ethyl 5-(butylcarbamoyl)-2-[(3-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCCCNC(=O)c1sc(NC(=O)c2cccc(F)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H23FN2O4S/c1-4-6-10-22-18(25)16-12(3)15(20(26)27-5-2)19(28-16)23-17(24)13-8-7-9-14(21)11-13/h7-9,11H,4-6,10H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | LVQYXGFQLAUINH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|