C22H28N2O6S — CID 17062590
ethyl 5-(butylcarbamoyl)-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 17062590) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 5-(butylcarbamoyl)-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(butylcarbamoyl)-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17062590 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | ethyl 5-(butylcarbamoyl)-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCCCNC(=O)c1sc(NC(=O)c2ccc(OC)c(OC)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H28N2O6S/c1-6-8-11-23-20(26)18-13(3)17(22(27)30-7-2)21(31-18)24-19(25)14-9-10-15(28-4)16(12-14)29-5/h9-10,12H,6-8,11H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | HAIRVCVETSSSBI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|