C19H22Cl2N4O3 — CID 170622636
4-[(3,5-dichloro-2-pyridinyl)oxy]-N-(6-methyl-3-pyridinyl)cyclohexane-1-carboxamide;formamide (PubChem CID 170622636) has the molecular formula C19H22Cl2N4O3 and a molecular weight of 425.32 g/mol. Its IUPAC name is 4-[(3,5-dichloro-2-pyridinyl)oxy]-N-(6-methyl-3-pyridinyl)cyclohexane-1-carboxamide;formamide.
| Compound Name | 4-[(3,5-dichloro-2-pyridinyl)oxy]-N-(6-methyl-3-pyridinyl)cyclohexane-1-carboxamide;formamide |
|---|---|
| PubChem CID | 170622636 |
| Molecular Formula | C19H22Cl2N4O3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[(3,5-dichloro-2-pyridinyl)oxy]-N-(6-methyl-3-pyridinyl)cyclohexane-1-carboxamide;formamide |
| SMILES | Cc1ccc(NC(=O)C2CCC(Oc3ncc(Cl)cc3Cl)CC2)cn1.NC=O |
| InChI | InChI=1S/C18H19Cl2N3O2.CH3NO/c1-11-2-5-14(10-21-11)23-17(24)12-3-6-15(7-4-12)25-18-16(20)8-13(19)9-22-18;2-1-3/h2,5,8-10,12,15H,3-4,6-7H2,1H3,(H,23,24);1H,(H2,2,3) |
| InChIKey | FEVIXMTUUKTSPQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|