C21H23Cl2N3O4 — CID 170622647
4-[[4-[(3,5-dichloro-2-pyridinyl)oxy]cyclohexanecarbonyl]amino]-N-methoxy-N-methylbenzamide (PubChem CID 170622647) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 4-[[4-[(3,5-dichloro-2-pyridinyl)oxy]cyclohexanecarbonyl]amino]-N-methoxy-N-methylbenzamide.
| Compound Name | 4-[[4-[(3,5-dichloro-2-pyridinyl)oxy]cyclohexanecarbonyl]amino]-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 170622647 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 4-[[4-[(3,5-dichloro-2-pyridinyl)oxy]cyclohexanecarbonyl]amino]-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1ccc(NC(=O)C2CCC(Oc3ncc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-26(29-2)21(28)14-3-7-16(8-4-14)25-19(27)13-5-9-17(10-6-13)30-20-18(23)11-15(22)12-24-20/h3-4,7-8,11-13,17H,5-6,9-10H2,1-2H3,(H,25,27) |
| InChIKey | WUAUOFXVKLGRJS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|