C23H31N3O2S — CID 170623052
N-(1-butylsulfanylpiperidin-4-yl)-N-(oxetan-2-ylmethyl)isoquinoline-3-carboxamide (PubChem CID 170623052) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is N-(1-butylsulfanylpiperidin-4-yl)-N-(oxetan-2-ylmethyl)isoquinoline-3-carboxamide.
| Compound Name | N-(1-butylsulfanylpiperidin-4-yl)-N-(oxetan-2-ylmethyl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 170623052 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-(1-butylsulfanylpiperidin-4-yl)-N-(oxetan-2-ylmethyl)isoquinoline-3-carboxamide |
| SMILES | CCCCSN1CCC(N(CC2CCO2)C(=O)c2cc3ccccc3cn2)CC1 |
| InChI | InChI=1S/C23H31N3O2S/c1-2-3-14-29-25-11-8-20(9-12-25)26(17-21-10-13-28-21)23(27)22-15-18-6-4-5-7-19(18)16-24-22/h4-7,15-16,20-21H,2-3,8-14,17H2,1H3 |
| InChIKey | BPNPWAYFVHQJJB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|