C9H4Cl2FIN2 — CID 170624317
2,4-dichloro-8-fluoro-6-iodo-5-methylquinazoline (PubChem CID 170624317) has the molecular formula C9H4Cl2FIN2 and a molecular weight of 356.95 g/mol. Its IUPAC name is 2,4-dichloro-8-fluoro-6-iodo-5-methylquinazoline.
| Compound Name | 2,4-dichloro-8-fluoro-6-iodo-5-methylquinazoline |
|---|---|
| PubChem CID | 170624317 |
| Molecular Formula | C9H4Cl2FIN2 |
| Molecular Weight | 356.95 g/mol |
| Exact Mass | 355.88 |
| IUPAC Name | 2,4-dichloro-8-fluoro-6-iodo-5-methylquinazoline |
| SMILES | Cc1c(I)cc(F)c2nc(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C9H4Cl2FIN2/c1-3-5(13)2-4(12)7-6(3)8(10)15-9(11)14-7/h2H,1H3 |
| InChIKey | SWKNMDCNHRLXBS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.95 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|