C38H53N9O4 — CID 170625120
3-(2,3-dihydroindol-1-yl)piperidine-2,6-dione;2-[(1Z)-1,4,4-triamino-3-[4-[[2-[cyclohexyl(methyl)amino]-3-hydroxypropyl]-ethylamino]pyrazol-1-yl]buta-1,3-dienyl]phenol (PubChem CID 170625120) has the molecular formula C38H53N9O4 and a molecular weight of 699.90 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)piperidine-2,6-dione;2-[(1Z)-1,4,4-triamino-3-[4-[[2-[cyclohexyl(methyl)amino]-3-hydroxypropyl]-ethylamino]pyrazol-1-yl]buta-1,3-dienyl]phenol.
| Compound Name | 3-(2,3-dihydroindol-1-yl)piperidine-2,6-dione;2-[(1Z)-1,4,4-triamino-3-[4-[[2-[cyclohexyl(methyl)amino]-3-hydroxypropyl]-ethylamino]pyrazol-1-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 170625120 |
| Molecular Formula | C38H53N9O4 |
| Molecular Weight | 699.90 g/mol |
| Exact Mass | 699.42 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)piperidine-2,6-dione;2-[(1Z)-1,4,4-triamino-3-[4-[[2-[cyclohexyl(methyl)amino]-3-hydroxypropyl]-ethylamino]pyrazol-1-yl]buta-1,3-dienyl]phenol |
| SMILES | CCN(CC(CO)N(C)C1CCCCC1)c1cnn(C(/C=C(\N)c2ccccc2O)=C(N)N)c1.O=C1CCC(N2CCc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C25H39N7O2.C13H14N2O2/c1-3-31(15-20(17-33)30(2)18-9-5-4-6-10-18)19-14-29-32(16-19)23(25(27)28)13-22(26)21-11-7-8-12-24(21)34;16-12-6-5-11(13(17)14-12)15-8-7-9-3-1-2-4-10(9)15/h7-8,11-14,16,18,20,33-34H,3-6,9-10,15,17,26-28H2,1-2H3;1-4,11H,5-8H2,(H,14,16,17)/b22-13-; |
| InChIKey | YMJSSWHBNNGACV-BWLGBDCWSA-N |
| XLogP | 2.94 |
| TPSA | 192.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|