C36H42F2N8O3 — CID 174369144
3-[3-[3,3-difluoro-1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]-2,6-dihydropyridin-4-yl]-N-methylanilino]piperidine-2,6-dione (PubChem CID 174369144) has the molecular formula C36H42F2N8O3 and a molecular weight of 672.78 g/mol. Its IUPAC name is 3-[3-[3,3-difluoro-1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]-2,6-dihydropyridin-4-yl]-N-methylanilino]piperidine-2,6-dione.
| Compound Name | 3-[3-[3,3-difluoro-1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]-2,6-dihydropyridin-4-yl]-N-methylanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174369144 |
| Molecular Formula | C36H42F2N8O3 |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | 3-[3-[3,3-difluoro-1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]-2,6-dihydropyridin-4-yl]-N-methylanilino]piperidine-2,6-dione |
| SMILES | CN(c1cccc(C2=CCN(C3CCC(n4cc(C(/C=C(\N)c5ccccc5O)=C(N)N)cn4)CC3)CC2(F)F)c1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C36H42F2N8O3/c1-44(31-13-14-33(48)43-35(31)49)26-6-4-5-22(17-26)29-15-16-45(21-36(29,37)38)24-9-11-25(12-10-24)46-20-23(19-42-46)28(34(40)41)18-30(39)27-7-2-3-8-32(27)47/h2-8,15,17-20,24-25,31,47H,9-14,16,21,39-41H2,1H3,(H,43,48,49)/b30-18- |
| InChIKey | KHHWSUKEZFATFX-YKQZZPSBSA-N |
| XLogP | 3.93 |
| TPSA | 168.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|